C18H16N2OS — CID 67990960
1-[4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]phenyl]ethanone (PubChem CID 67990960) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-[4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]phenyl]ethanone.
| Compound Name | 1-[4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 67990960 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N(C)c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H16N2OS/c1-13(21)14-8-10-16(11-9-14)20(2)17-12-22-18(19-17)15-6-4-3-5-7-15/h3-12H,1-2H3 |
| InChIKey | XZKVGIGQXILTDR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |