C20H23BINO5 — CID 67991503
2-[2-[(2-iodo-5-nitrophenoxy)methyl]-4-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 67991503) has the molecular formula C20H23BINO5 and a molecular weight of 495.12 g/mol. Its IUPAC name is 2-[2-[(2-iodo-5-nitrophenoxy)methyl]-4-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[(2-iodo-5-nitrophenoxy)methyl]-4-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 67991503 |
| Molecular Formula | C20H23BINO5 |
| Molecular Weight | 495.12 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 2-[2-[(2-iodo-5-nitrophenoxy)methyl]-4-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(COc2cc([N+](=O)[O-])ccc2I)c1 |
| InChI | InChI=1S/C20H23BINO5/c1-13-6-8-16(21-27-19(2,3)20(4,5)28-21)14(10-13)12-26-18-11-15(23(24)25)7-9-17(18)22/h6-11H,12H2,1-5H3 |
| InChIKey | LLDWZOZKUGEEPZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.12 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|