C17H25NO3S — CID 67991696
[4-[2-(propanoylamino)ethyl]phenyl] 2-tert-butylsulfanylacetate (PubChem CID 67991696) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is [4-[2-(propanoylamino)ethyl]phenyl] 2-tert-butylsulfanylacetate.
| Compound Name | [4-[2-(propanoylamino)ethyl]phenyl] 2-tert-butylsulfanylacetate |
|---|---|
| PubChem CID | 67991696 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [4-[2-(propanoylamino)ethyl]phenyl] 2-tert-butylsulfanylacetate |
| SMILES | CCC(=O)NCCc1ccc(OC(=O)CSC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-5-15(19)18-11-10-13-6-8-14(9-7-13)21-16(20)12-22-17(2,3)4/h6-9H,5,10-12H2,1-4H3,(H,18,19) |
| InChIKey | RQGUJTLYPBLPEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|