C20H26BrN3O2 — CID 67992942
tert-butyl 2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-5-ethylpyrrolidine-1-carboxylate (PubChem CID 67992942) has the molecular formula C20H26BrN3O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is tert-butyl 2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-5-ethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-5-ethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67992942 |
| Molecular Formula | C20H26BrN3O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | tert-butyl 2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-5-ethylpyrrolidine-1-carboxylate |
| SMILES | CCC1CCC(c2ncc(-c3ccc(Br)cc3)[nH]2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26BrN3O2/c1-5-15-10-11-17(24(15)19(25)26-20(2,3)4)18-22-12-16(23-18)13-6-8-14(21)9-7-13/h6-9,12,15,17H,5,10-11H2,1-4H3,(H,22,23) |
| InChIKey | UZGZGEJGSJBMAP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |