C18H21BrN3O2+ — CID 123671831
tert-butyl (2S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2,3,4,5-tetrahydropyrrol-4-ylium-1-carboxylate (PubChem CID 123671831) has the molecular formula C18H21BrN3O2+ and a molecular weight of 391.29 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2,3,4,5-tetrahydropyrrol-4-ylium-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2,3,4,5-tetrahydropyrrol-4-ylium-1-carboxylate |
|---|---|
| PubChem CID | 123671831 |
| Molecular Formula | C18H21BrN3O2+ |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | tert-butyl (2S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2,3,4,5-tetrahydropyrrol-4-ylium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[CH+]C[C@H]1c1ncc(-c2ccc(Br)cc2)[nH]1 |
| InChI | InChI=1S/C18H21BrN3O2/c1-18(2,3)24-17(23)22-10-4-5-15(22)16-20-11-14(21-16)12-6-8-13(19)9-7-12/h4,6-9,11,15H,5,10H2,1-3H3,(H,20,21)/q+1/t15-/m0/s1 |
| InChIKey | JMEKMOCOSKOPBU-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|