C16H15ClO — CID 67993539
7-chlorospiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-1-ene]-1-one (PubChem CID 67993539) has the molecular formula C16H15ClO and a molecular weight of 258.75 g/mol. Its IUPAC name is 7-chlorospiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-1-ene]-1-one.
| Compound Name | 7-chlorospiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-1-ene]-1-one |
|---|---|
| PubChem CID | 67993539 |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 7-chlorospiro[2,4-dihydronaphthalene-3,5'-bicyclo[2.2.1]hept-1-ene]-1-one |
| SMILES | O=C1CC2(CC3=CCC2C3)Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H15ClO/c17-13-4-2-11-8-16(9-15(18)14(11)6-13)7-10-1-3-12(16)5-10/h1-2,4,6,12H,3,5,7-9H2 |
| InChIKey | NECZUSLHKUSHOX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|