C18H18ClN5O2 — CID 67994264
1-[1-(5-chloro-2-nitrophenyl)piperidin-4-yl]benzimidazol-2-amine (PubChem CID 67994264) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-nitrophenyl)piperidin-4-yl]benzimidazol-2-amine.
| Compound Name | 1-[1-(5-chloro-2-nitrophenyl)piperidin-4-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 67994264 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[1-(5-chloro-2-nitrophenyl)piperidin-4-yl]benzimidazol-2-amine |
| SMILES | Nc1nc2ccccc2n1C1CCN(c2cc(Cl)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H18ClN5O2/c19-12-5-6-16(24(25)26)17(11-12)22-9-7-13(8-10-22)23-15-4-2-1-3-14(15)21-18(23)20/h1-6,11,13H,7-10H2,(H2,20,21) |
| InChIKey | QYQOYAIEDIJQQU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|