C27H31N5O5S — CID 67996109
6-[[[(2R,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 67996109) has the molecular formula C27H31N5O5S and a molecular weight of 537.64 g/mol. Its IUPAC name is 6-[[[(2R,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[[(2R,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 67996109 |
| Molecular Formula | C27H31N5O5S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 6-[[[(2R,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | COc1ccc2nccc(C=C[C@@H]3CC[C@@H](NCc4ccc5c(n4)NC(=O)CS5)[C@@H](C[C@H](O)CO)O3)c2n1 |
| InChI | InChI=1S/C27H31N5O5S/c1-36-25-9-7-21-26(32-25)16(10-11-28-21)2-4-19-5-6-20(22(37-19)12-18(34)14-33)29-13-17-3-8-23-27(30-17)31-24(35)15-38-23/h2-4,7-11,18-20,22,29,33-34H,5-6,12-15H2,1H3,(H,30,31,35)/t18-,19+,20+,22+/m0/s1 |
| InChIKey | NWYPHKAHPGTQSN-GPQLQYNLSA-N |
| XLogP | 2.54 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |