C43H40BrFN4O3 — CID 67996835
tert-butyl 3-[(3-bromo-1-tritylindazole-5-carbonyl)amino]-4-(3-fluorophenyl)piperidine-1-carboxylate (PubChem CID 67996835) has the molecular formula C43H40BrFN4O3 and a molecular weight of 759.72 g/mol. Its IUPAC name is tert-butyl 3-[(3-bromo-1-tritylindazole-5-carbonyl)amino]-4-(3-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-bromo-1-tritylindazole-5-carbonyl)amino]-4-(3-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67996835 |
| Molecular Formula | C43H40BrFN4O3 |
| Molecular Weight | 759.72 g/mol |
| Exact Mass | 758.23 |
| IUPAC Name | tert-butyl 3-[(3-bromo-1-tritylindazole-5-carbonyl)amino]-4-(3-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc(F)c2)C(NC(=O)c2ccc3c(c2)c(Br)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C43H40BrFN4O3/c1-42(2,3)52-41(51)48-25-24-35(29-14-13-21-34(45)26-29)37(28-48)46-40(50)30-22-23-38-36(27-30)39(44)47-49(38)43(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-23,26-27,35,37H,24-25,28H2,1-3H3,(H,46,50) |
| InChIKey | QXFCSBWRMBIUBG-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.72 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|