C18H20FN5O4 — CID 67996856
1-[2-fluoro-4-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxylic acid (PubChem CID 67996856) has the molecular formula C18H20FN5O4 and a molecular weight of 389.39 g/mol. Its IUPAC name is 1-[2-fluoro-4-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-fluoro-4-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67996856 |
| Molecular Formula | C18H20FN5O4 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[2-fluoro-4-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxylic acid |
| SMILES | CNc1ccc([N+](=O)[O-])c(Nc2ccc(N3CCC(C(=O)O)CC3)c(F)c2)n1 |
| InChI | InChI=1S/C18H20FN5O4/c1-20-16-5-4-15(24(27)28)17(22-16)21-12-2-3-14(13(19)10-12)23-8-6-11(7-9-23)18(25)26/h2-5,10-11H,6-9H2,1H3,(H,25,26)(H2,20,21,22) |
| InChIKey | DZKFVMBWLHHQOK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|