C13H18N4O6 — CID 3816448
4-[[6-(3-carboxypropylamino)-5-nitro-2-pyridinyl]amino]butanoic acid (PubChem CID 3816448) has the molecular formula C13H18N4O6 and a molecular weight of 326.31 g/mol. Its IUPAC name is 4-[[6-(3-carboxypropylamino)-5-nitro-2-pyridinyl]amino]butanoic acid.
| Compound Name | 4-[[6-(3-carboxypropylamino)-5-nitro-2-pyridinyl]amino]butanoic acid |
|---|---|
| PubChem CID | 3816448 |
| Molecular Formula | C13H18N4O6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-[[6-(3-carboxypropylamino)-5-nitro-2-pyridinyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1ccc([N+](=O)[O-])c(NCCCC(=O)O)n1 |
| InChI | InChI=1S/C13H18N4O6/c18-11(19)3-1-7-14-10-6-5-9(17(22)23)13(16-10)15-8-2-4-12(20)21/h5-6H,1-4,7-8H2,(H,18,19)(H,20,21)(H2,14,15,16) |
| InChIKey | PNTFSYPTVODFOR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|