C17H22ClNO3 — CID 67997030
3-[(1S)-1-(2-chlorophenyl)ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one (PubChem CID 67997030) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 3-[(1S)-1-(2-chlorophenyl)ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one.
| Compound Name | 3-[(1S)-1-(2-chlorophenyl)ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 67997030 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[(1S)-1-(2-chlorophenyl)ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one |
| SMILES | C[C@@H](c1ccccc1Cl)N1CCC2(CCC(O)CC2)OC1=O |
| InChI | InChI=1S/C17H22ClNO3/c1-12(14-4-2-3-5-15(14)18)19-11-10-17(22-16(19)21)8-6-13(20)7-9-17/h2-5,12-13,20H,6-11H2,1H3/t12-,13?,17?/m0/s1 |
| InChIKey | JXVLNVQEXPKIDB-POZPTJLLSA-N |
| XLogP | 3.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |