C16H16F3N5O — CID 67998411
(1S,3R,4S)-3-methyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide (PubChem CID 67998411) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is (1S,3R,4S)-3-methyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide.
| Compound Name | (1S,3R,4S)-3-methyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 67998411 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (1S,3R,4S)-3-methyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H](C(N)=O)C[C@@H]1c1nc(C(F)(F)F)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C16H16F3N5O/c1-7-4-8(13(20)25)5-9(7)15-23-12(16(17,18)19)11-6-22-14-10(24(11)15)2-3-21-14/h2-3,6-9,21H,4-5H2,1H3,(H2,20,25)/t7-,8+,9+/m1/s1 |
| InChIKey | DFSRVFOZMIKYAF-VGMNWLOBSA-N |
| XLogP | 2.84 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |