C18H19F2N5O — CID 58557128
(3,3-difluorocyclobutyl)-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone (PubChem CID 58557128) has the molecular formula C18H19F2N5O and a molecular weight of 359.38 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone.
| Compound Name | (3,3-difluorocyclobutyl)-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58557128 |
| Molecular Formula | C18H19F2N5O |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CC(F)(F)C1)N1CCC[C@@H](c2ncc3cnc4[nH]ccc4n23)C1 |
| InChI | InChI=1S/C18H19F2N5O/c19-18(20)6-12(7-18)17(26)24-5-1-2-11(10-24)16-23-9-13-8-22-15-14(25(13)16)3-4-21-15/h3-4,8-9,11-12,21H,1-2,5-7,10H2/t11-/m1/s1 |
| InChIKey | IFRJBGYCCGSMHR-LLVKDONJSA-N |
| XLogP | 2.96 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |