C30H26O13 — CID 67999833
5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(3S,4S,5S,6S)-3,4,5-trihydroxy-6-[1-hydroxy-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]oxychromen-4-one (PubChem CID 67999833) has the molecular formula C30H26O13 and a molecular weight of 594.53 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(3S,4S,5S,6S)-3,4,5-trihydroxy-6-[1-hydroxy-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]oxychromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(3S,4S,5S,6S)-3,4,5-trihydroxy-6-[1-hydroxy-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 67999833 |
| Molecular Formula | C30H26O13 |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(3S,4S,5S,6S)-3,4,5-trihydroxy-6-[1-hydroxy-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]oxan-2-yl]oxychromen-4-one |
| SMILES | O=C(C=Cc1ccc(O)cc1)C(O)[C@H]1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O13/c31-15-6-1-13(2-7-15)3-10-18(34)22(36)28-25(39)24(38)26(40)30(42-28)43-29-23(37)21-19(35)11-17(33)12-20(21)41-27(29)14-4-8-16(32)9-5-14/h1-12,22,24-26,28,30-33,35-36,38-40H/t22?,24-,25-,26-,28+,30?/m0/s1 |
| InChIKey | LHCCZUZIJMDREH-VLEJYAHKSA-N |
| XLogP | 1.11 |
| TPSA | 227.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|