C18H24ClN3O2 — CID 680027
(3R,3aS,6aS)-3-(4-chlorophenyl)-5-cyclohexyl-6a-hydroxy-2-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 680027) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-(4-chlorophenyl)-5-cyclohexyl-6a-hydroxy-2-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | (3R,3aS,6aS)-3-(4-chlorophenyl)-5-cyclohexyl-6a-hydroxy-2-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 680027 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (3R,3aS,6aS)-3-(4-chlorophenyl)-5-cyclohexyl-6a-hydroxy-2-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | CN1N[C@@]2(O)C(=O)N(C3CCCCC3)C[C@H]2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3O2/c1-21-16(12-7-9-13(19)10-8-12)15-11-22(14-5-3-2-4-6-14)17(23)18(15,24)20-21/h7-10,14-16,20,24H,2-6,11H2,1H3/t15-,16-,18-/m0/s1 |
| InChIKey | UJDLRZZPNQIDGQ-BQFCYCMXSA-N |
| XLogP | 2.31 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |