C7H9N3O3 — CID 680913
methyl 2-(1H-pyrazole-5-carbonylamino)acetate (PubChem CID 680913) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is methyl 2-(1H-pyrazole-5-carbonylamino)acetate.
| Compound Name | methyl 2-(1H-pyrazole-5-carbonylamino)acetate |
|---|---|
| PubChem CID | 680913 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | methyl 2-(1H-pyrazole-5-carbonylamino)acetate |
| SMILES | COC(=O)CNC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C7H9N3O3/c1-13-6(11)4-8-7(12)5-2-3-9-10-5/h2-3H,4H2,1H3,(H,8,12)(H,9,10) |
| InChIKey | HSFDTHFNNNKSML-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |