About 1-nitro-2-phenylbenzene
1-nitro-2-phenylbenzene (PubChem CID 6829) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-nitro-2-phenylbenzene.
Molecular Properties
| Compound Name | 1-nitro-2-phenylbenzene |
| PubChem CID | 6829 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1-nitro-2-phenylbenzene |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H9NO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | YOJKKXRJMXIKSR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-2-phenylbenzene?
The IUPAC name of 1-nitro-2-phenylbenzene (CID 6829) is 1-nitro-2-phenylbenzene.
What is the SMILES notation for 1-nitro-2-phenylbenzene?
The canonical SMILES for 1-nitro-2-phenylbenzene is O=[N+]([O-])c1ccccc1-c1ccccc1.
What is the InChIKey of 1-nitro-2-phenylbenzene?
The InChIKey is YOJKKXRJMXIKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H.
What are the key properties of 1-nitro-2-phenylbenzene?
1-nitro-2-phenylbenzene has a molecular weight of 199.21 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-2-phenylbenzene is sourced from PubChem (CID 6829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).