C19H21FN2O2 — CID 68312771
(2R)-2-[[6-(1-benzofuran-5-yl)-3-fluoro-2-pyridinyl]methylamino]-3-methylbutan-1-ol (PubChem CID 68312771) has the molecular formula C19H21FN2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is (2R)-2-[[6-(1-benzofuran-5-yl)-3-fluoro-2-pyridinyl]methylamino]-3-methylbutan-1-ol.
| Compound Name | (2R)-2-[[6-(1-benzofuran-5-yl)-3-fluoro-2-pyridinyl]methylamino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 68312771 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-2-[[6-(1-benzofuran-5-yl)-3-fluoro-2-pyridinyl]methylamino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@H](CO)NCC1=C(C=CC(=N1)C2=CC3=C(C=C2)OC=C3)F |
| InChI | InChI=1S/C19H21FN2O2/c1-12(2)18(11-23)21-10-17-15(20)4-5-16(22-17)13-3-6-19-14(9-13)7-8-24-19/h3-9,12,18,21,23H,10-11H2,1-2H3/t18-/m0/s1 |
| InChIKey | NKRCFTMBBAWMAX-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 58.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 396 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |