C34H28N6O2 — CID 6833105
5-methyl-4-[[4-[4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methylamino]phenyl]anilino]methylidene]-2-phenylpyrazol-3-one (PubChem CID 6833105) has the molecular formula C34H28N6O2 and a molecular weight of 552.64 g/mol. Its IUPAC name is 5-methyl-4-[[4-[4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methylamino]phenyl]anilino]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | 5-methyl-4-[[4-[4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methylamino]phenyl]anilino]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6833105 |
| Molecular Formula | C34H28N6O2 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 5-methyl-4-[[4-[4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methylamino]phenyl]anilino]methylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=CNc1ccc(-c2ccc(NC=C3C(=O)N(c4ccccc4)N=C3C)cc2)cc1 |
| InChI | InChI=1S/C34H28N6O2/c1-23-31(33(41)39(37-23)29-9-5-3-6-10-29)21-35-27-17-13-25(14-18-27)26-15-19-28(20-16-26)36-22-32-24(2)38-40(34(32)42)30-11-7-4-8-12-30/h3-22,35-36H,1-2H3 |
| InChIKey | REDPNWWDUNGPCR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|