C14H12N4OS — CID 684400
N-naphthalen-1-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 684400) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-naphthalen-1-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 684400 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-naphthalen-1-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1ncn[nH]1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C14H12N4OS/c19-13(8-20-14-15-9-16-18-14)17-12-7-3-5-10-4-1-2-6-11(10)12/h1-7,9H,8H2,(H,17,19)(H,15,16,18) |
| InChIKey | QPSYVTLHPVDNGY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |