C17H18N2O2Zn — CID 6849043
6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]propylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc (PubChem CID 6849043) has the molecular formula C17H18N2O2Zn and a molecular weight of 347.73 g/mol. Its IUPAC name is 6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]propylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc.
| Compound Name | 6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]propylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc |
|---|---|
| PubChem CID | 6849043 |
| Molecular Formula | C17H18N2O2Zn |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]propylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc |
| SMILES | CC(CNC=C1C=CC=CC1=O)NC=C1C=CC=CC1=O.[Zn] |
| InChI | InChI=1S/C17H18N2O2.Zn/c1-13(19-12-15-7-3-5-9-17(15)21)10-18-11-14-6-2-4-8-16(14)20;/h2-9,11-13,18-19H,10H2,1H3; |
| InChIKey | ZBBXXRJFONBIHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|