C18H20N2O2Zn — CID 5385183
(6Z)-4-methyl-6-[[2-[[(Z)-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc (PubChem CID 5385183) has the molecular formula C18H20N2O2Zn and a molecular weight of 361.76 g/mol. Its IUPAC name is (6Z)-4-methyl-6-[[2-[[(Z)-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc.
| Compound Name | (6Z)-4-methyl-6-[[2-[[(Z)-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc |
|---|---|
| PubChem CID | 5385183 |
| Molecular Formula | C18H20N2O2Zn |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (6Z)-4-methyl-6-[[2-[[(Z)-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;zinc |
| SMILES | CC1=C/C(=C/NCCN/C=C2/C=C(C)C=CC2=O)C(=O)C=C1.[Zn] |
| InChI | InChI=1S/C18H20N2O2.Zn/c1-13-3-5-17(21)15(9-13)11-19-7-8-20-12-16-10-14(2)4-6-18(16)22;/h3-6,9-12,19-20H,7-8H2,1-2H3;/b15-11-,16-12-; |
| InChIKey | SKTCEPBKTKTPNZ-LEITXRBGSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|