C16H18CuN2O2 — CID 5473425
copper;bis((6Z)-6-(methylaminomethylidene)cyclohexa-2,4-dien-1-one) (PubChem CID 5473425) has the molecular formula C16H18CuN2O2 and a molecular weight of 333.88 g/mol. Its IUPAC name is copper;bis((6Z)-6-(methylaminomethylidene)cyclohexa-2,4-dien-1-one).
| Compound Name | copper;bis((6Z)-6-(methylaminomethylidene)cyclohexa-2,4-dien-1-one) |
|---|---|
| PubChem CID | 5473425 |
| Molecular Formula | C16H18CuN2O2 |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | copper;bis((6Z)-6-(methylaminomethylidene)cyclohexa-2,4-dien-1-one) |
| SMILES | CN/C=C1/C=CC=CC1=O.CN/C=C1/C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/2C8H9NO.Cu/c2*1-9-6-7-4-2-3-5-8(7)10;/h2*2-6,9H,1H3;/b2*7-6-; |
| InChIKey | PXHALHQZBZARDH-SVDRMMRJSA-N |
| XLogP | 1.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|