C20H26N2Na2O2-4 — CID 59977943
disodium;carbanide;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 59977943) has the molecular formula C20H26N2Na2O2-4 and a molecular weight of 372.42 g/mol. Its IUPAC name is disodium;carbanide;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | disodium;carbanide;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 59977943 |
| Molecular Formula | C20H26N2Na2O2-4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | disodium;carbanide;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=C[C-]=CC1=CNCCNC=C1C=[C-]C=CC1=O.[CH3-].[CH3-].[CH3-].[CH3-].[Na+].[Na+] |
| InChI | InChI=1S/C16H14N2O2.4CH3.2Na/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;;;;;/h3-8,11-12,17-18H,9-10H2;4*1H3;;/q-2;4*-1;2*+1 |
| InChIKey | MVUAGRGTZTXIBQ-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|