C22H30CuN2O2 — CID 5474159
bis((6Z)-6-(butylaminomethylidene)cyclohexa-2,4-dien-1-one);copper (PubChem CID 5474159) has the molecular formula C22H30CuN2O2 and a molecular weight of 418.04 g/mol. Its IUPAC name is bis((6Z)-6-(butylaminomethylidene)cyclohexa-2,4-dien-1-one);copper.
| Compound Name | bis((6Z)-6-(butylaminomethylidene)cyclohexa-2,4-dien-1-one);copper |
|---|---|
| PubChem CID | 5474159 |
| Molecular Formula | C22H30CuN2O2 |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | bis((6Z)-6-(butylaminomethylidene)cyclohexa-2,4-dien-1-one);copper |
| SMILES | CCCCN/C=C1/C=CC=CC1=O.CCCCN/C=C1/C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/2C11H15NO.Cu/c2*1-2-3-8-12-9-10-6-4-5-7-11(10)13;/h2*4-7,9,12H,2-3,8H2,1H3;/b2*10-9-; |
| InChIKey | SZHIUVLJPNYDPS-CVBJKYQLSA-N |
| XLogP | 3.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|