C7H14NO3P — CID 68501514
1-bicyclo[2.2.1]heptanyloxy-dihydroxy-imino-λ5-phosphane (PubChem CID 68501514) has the molecular formula C7H14NO3P and a molecular weight of 191.17 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]heptanyloxy-dihydroxy-imino-λ5-phosphane.
| Compound Name | 1-bicyclo[2.2.1]heptanyloxy-dihydroxy-imino-λ5-phosphane |
|---|---|
| PubChem CID | 68501514 |
| Molecular Formula | C7H14NO3P |
| Molecular Weight | 191.17 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1-bicyclo[2.2.1]heptanyloxy-dihydroxy-imino-λ5-phosphane |
| SMILES | [H]N=P(O)(O)OC12CCC(CC1)C2 |
| InChI | InChI=1S/C7H14NO3P/c8-12(9,10)11-7-3-1-6(5-7)2-4-7/h6H,1-5H2,(H3,8,9,10) |
| InChIKey | NUDORIRNYKYIBF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|