C14H24O4P2S2 — CID 87476806
1-bicyclo[2.2.1]heptanyl-[1-bicyclo[2.2.1]heptanyl(hydroxy)phosphinothioyl]peroxy-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 87476806) has the molecular formula C14H24O4P2S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]heptanyl-[1-bicyclo[2.2.1]heptanyl(hydroxy)phosphinothioyl]peroxy-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | 1-bicyclo[2.2.1]heptanyl-[1-bicyclo[2.2.1]heptanyl(hydroxy)phosphinothioyl]peroxy-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 87476806 |
| Molecular Formula | C14H24O4P2S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1-bicyclo[2.2.1]heptanyl-[1-bicyclo[2.2.1]heptanyl(hydroxy)phosphinothioyl]peroxy-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | OP(=S)(OOP(O)(=S)C12CCC(CC1)C2)C12CCC(CC1)C2 |
| InChI | InChI=1S/C14H24O4P2S2/c15-19(21,13-5-1-11(9-13)2-6-13)17-18-20(16,22)14-7-3-12(10-14)4-8-14/h11-12H,1-10H2,(H,15,21)(H,16,22) |
| InChIKey | JESUMMMYDDBCCG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|