C20H19NO — CID 68501652
(3R)-3-cyclopropyl-N,5-diphenylpent-4-ynamide (PubChem CID 68501652) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (3R)-3-cyclopropyl-N,5-diphenylpent-4-ynamide.
| Compound Name | (3R)-3-cyclopropyl-N,5-diphenylpent-4-ynamide |
|---|---|
| PubChem CID | 68501652 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3R)-3-cyclopropyl-N,5-diphenylpent-4-ynamide |
| SMILES | O=C(C[C@@H](C#Cc1ccccc1)C1CC1)Nc1ccccc1 |
| InChI | InChI=1S/C20H19NO/c22-20(21-19-9-5-2-6-10-19)15-18(17-13-14-17)12-11-16-7-3-1-4-8-16/h1-10,17-18H,13-15H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | YRUAGXNLPFZUNL-GOSISDBHSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|