C21H18F2N6O2S — CID 68502165
3-[5-(2,5-difluorophenyl)-3-(4-nitropyrimidin-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 68502165) has the molecular formula C21H18F2N6O2S and a molecular weight of 456.48 g/mol. Its IUPAC name is 3-[5-(2,5-difluorophenyl)-3-(4-nitropyrimidin-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | 3-[5-(2,5-difluorophenyl)-3-(4-nitropyrimidin-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 68502165 |
| Molecular Formula | C21H18F2N6O2S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-[5-(2,5-difluorophenyl)-3-(4-nitropyrimidin-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1c1nccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H18F2N6O2S/c22-15-7-8-17(23)16(13-15)19-27-28(20-25-12-9-18(26-20)29(30)31)21(32-19,10-4-11-24)14-5-2-1-3-6-14/h1-3,5-9,12-13H,4,10-11,24H2 |
| InChIKey | KABQACORBLRTJJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|