C20H18F2N6O2S2 — CID 90269190
3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 90269190) has the molecular formula C20H18F2N6O2S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | 3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 90269190 |
| Molecular Formula | C20H18F2N6O2S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | Cc1nnc(N2N=C(c3cc(F)ccc3F)SC2(CCCN)c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C20H18F2N6O2S2/c1-12-24-25-19(31-12)27-20(8-3-9-23,13-4-2-5-15(10-13)28(29)30)32-18(26-27)16-11-14(21)6-7-17(16)22/h2,4-7,10-11H,3,8-9,23H2,1H3 |
| InChIKey | AXIWCPAQSAIGEX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|