C26H21F2N7O4S2 — CID 87573950
3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)propan-1-amine (PubChem CID 87573950) has the molecular formula C26H21F2N7O4S2 and a molecular weight of 597.63 g/mol. Its IUPAC name is 3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)propan-1-amine.
| Compound Name | 3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)propan-1-amine |
|---|---|
| PubChem CID | 87573950 |
| Molecular Formula | C26H21F2N7O4S2 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | 3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)propan-1-amine |
| SMILES | Cc1nnc(N2N=C(c3cc(F)ccc3F)SC2(CCC(N)c2cccc([N+](=O)[O-])c2)c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C26H21F2N7O4S2/c1-15-30-31-25(40-15)33-26(17-5-3-7-20(13-17)35(38)39,41-24(32-33)21-14-18(27)8-9-22(21)28)11-10-23(29)16-4-2-6-19(12-16)34(36)37/h2-9,12-14,23H,10-11,29H2,1H3 |
| InChIKey | OYKMQOUYXHPWQQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|