C26H29F2N7O2S2 — CID 68507267
2-amino-N-[1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propylamino]-1-oxopropan-2-yl]propanamide (PubChem CID 68507267) has the molecular formula C26H29F2N7O2S2 and a molecular weight of 573.70 g/mol. Its IUPAC name is 2-amino-N-[1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propylamino]-1-oxopropan-2-yl]propanamide.
| Compound Name | 2-amino-N-[1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propylamino]-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 68507267 |
| Molecular Formula | C26H29F2N7O2S2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 2-amino-N-[1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propylamino]-1-oxopropan-2-yl]propanamide |
| SMILES | Cc1nnc(N2N=C(c3cc(F)ccc3F)SC2(CCCNC(=O)C(C)NC(=O)C(C)N)c2ccccc2)s1 |
| InChI | InChI=1S/C26H29F2N7O2S2/c1-15(29)22(36)31-16(2)23(37)30-13-7-12-26(18-8-5-4-6-9-18)35(25-33-32-17(3)38-25)34-24(39-26)20-14-19(27)10-11-21(20)28/h4-6,8-11,14-16H,7,12-13,29H2,1-3H3,(H,30,37)(H,31,36) |
| InChIKey | YWOYLPICTPWOFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|