C22H25F2N3O4S2 — CID 67215158
N-[3-[5-(2,5-difluorophenyl)-3-(2-methoxypropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]methanesulfonamide (PubChem CID 67215158) has the molecular formula C22H25F2N3O4S2 and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[3-[5-(2,5-difluorophenyl)-3-(2-methoxypropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[5-(2,5-difluorophenyl)-3-(2-methoxypropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 67215158 |
| Molecular Formula | C22H25F2N3O4S2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | N-[3-[5-(2,5-difluorophenyl)-3-(2-methoxypropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]methanesulfonamide |
| SMILES | COC(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCNS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C22H25F2N3O4S2/c1-15(31-2)21(28)27-22(16-8-5-4-6-9-16,12-7-13-25-33(3,29)30)32-20(26-27)18-14-17(23)10-11-19(18)24/h4-6,8-11,14-15,25H,7,12-13H2,1-3H3 |
| InChIKey | WJKNKXPLOSEDOM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|