C23H25F3N4O2S — CID 59192990
N'-[3-[(2S)-5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-fluoroethanimidamide (PubChem CID 59192990) has the molecular formula C23H25F3N4O2S and a molecular weight of 478.54 g/mol. Its IUPAC name is N'-[3-[(2S)-5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-fluoroethanimidamide.
| Compound Name | N'-[3-[(2S)-5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-fluoroethanimidamide |
|---|---|
| PubChem CID | 59192990 |
| Molecular Formula | C23H25F3N4O2S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N'-[3-[(2S)-5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-fluoroethanimidamide |
| SMILES | CO[C@@H](C)C(=O)N1N=C(c2cc(F)ccc2F)S[C@@]1(CCC/N=C(/N)CF)c1ccccc1 |
| InChI | InChI=1S/C23H25F3N4O2S/c1-15(32-2)22(31)30-23(16-7-4-3-5-8-16,11-6-12-28-20(27)14-24)33-21(29-30)18-13-17(25)9-10-19(18)26/h3-5,7-10,13,15H,6,11-12,14H2,1-2H3,(H2,27,28)/t15-,23-/m0/s1 |
| InChIKey | PULFZLKARHVIDQ-WNSKOXEYSA-N |
| XLogP | 4.20 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|