C22H26ClF2N5O3S — CID 86639130
2-[2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl]-1-methoxyguanidine;hydrochloride (PubChem CID 86639130) has the molecular formula C22H26ClF2N5O3S and a molecular weight of 514.00 g/mol. Its IUPAC name is 2-[2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl]-1-methoxyguanidine;hydrochloride.
| Compound Name | 2-[2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl]-1-methoxyguanidine;hydrochloride |
|---|---|
| PubChem CID | 86639130 |
| Molecular Formula | C22H26ClF2N5O3S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-[2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl]-1-methoxyguanidine;hydrochloride |
| SMILES | CON/C(N)=N/CCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@H](C)OC.Cl |
| InChI | InChI=1S/C22H25F2N5O3S.ClH/c1-14(31-2)20(30)29-22(15-7-5-4-6-8-15,11-12-26-21(25)28-32-3)33-19(27-29)17-13-16(23)9-10-18(17)24;/h4-10,13-14H,11-12H2,1-3H3,(H3,25,26,28);1H/t14-,22?;/m0./s1 |
| InChIKey | WGIYJLZVYMKGID-IDHPKLQESA-N |
| XLogP | 3.37 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|