C21H24F2N6OS — CID 89253393
2-[2-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethylamino]guanidine (PubChem CID 89253393) has the molecular formula C21H24F2N6OS and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-[2-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethylamino]guanidine.
| Compound Name | 2-[2-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethylamino]guanidine |
|---|---|
| PubChem CID | 89253393 |
| Molecular Formula | C21H24F2N6OS |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[2-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethylamino]guanidine |
| SMILES | CC(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCNN=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C21H24F2N6OS/c1-13(2)19(30)29-21(10-11-26-27-20(24)25,14-6-4-3-5-7-14)31-18(28-29)16-12-15(22)8-9-17(16)23/h3-9,12-13,26H,10-11H2,1-2H3,(H4,24,25,27) |
| InChIKey | SAXSJARAOJIJND-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|