C21H22F2N4O2S — CID 68549476
4-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]butanimidamide (PubChem CID 68549476) has the molecular formula C21H22F2N4O2S and a molecular weight of 432.50 g/mol. Its IUPAC name is 4-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]butanimidamide.
| Compound Name | 4-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]butanimidamide |
|---|---|
| PubChem CID | 68549476 |
| Molecular Formula | C21H22F2N4O2S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]butanimidamide |
| SMILES | [H]/N=C(\N)CCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@H](C)O |
| InChI | InChI=1S/C21H22F2N4O2S/c1-13(28)20(29)27-21(11-5-8-18(24)25,14-6-3-2-4-7-14)30-19(26-27)16-12-15(22)9-10-17(16)23/h2-4,6-7,9-10,12-13,28H,5,8,11H2,1H3,(H3,24,25)/t13-,21?/m0/s1 |
| InChIKey | POLAPAPNLCKZNP-JRTLGTJJSA-N |
| XLogP | 3.54 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|