C23H23F2N5O2S — CID 87491998
N-cyano-N'-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]ethanimidamide (PubChem CID 87491998) has the molecular formula C23H23F2N5O2S and a molecular weight of 471.53 g/mol. Its IUPAC name is N-cyano-N'-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]ethanimidamide.
| Compound Name | N-cyano-N'-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]ethanimidamide |
|---|---|
| PubChem CID | 87491998 |
| Molecular Formula | C23H23F2N5O2S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-cyano-N'-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]ethanimidamide |
| SMILES | C/C(=N\CCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@H](C)O)NC#N |
| InChI | InChI=1S/C23H23F2N5O2S/c1-15(31)22(32)30-23(17-7-4-3-5-8-17,11-6-12-27-16(2)28-14-26)33-21(29-30)19-13-18(24)9-10-20(19)25/h3-5,7-10,13,15,31H,6,11-12H2,1-2H3,(H,27,28)/t15-,23?/m0/s1 |
| InChIKey | RVVWTIJRGKXHNH-NGMICRHFSA-N |
| XLogP | 3.70 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|