C29H36F2N6O2S — CID 87494882
1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-3-methyl-2-(2-methylpropoxy)butanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine (PubChem CID 87494882) has the molecular formula C29H36F2N6O2S and a molecular weight of 570.71 g/mol. Its IUPAC name is 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-3-methyl-2-(2-methylpropoxy)butanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-3-methyl-2-(2-methylpropoxy)butanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 87494882 |
| Molecular Formula | C29H36F2N6O2S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-3-methyl-2-(2-methylpropoxy)butanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@@H](OCC(C)C)C(C)C |
| InChI | InChI=1S/C29H36F2N6O2S/c1-19(2)17-39-25(20(3)4)27(38)37-29(21-10-7-6-8-11-21,14-9-15-34-28(33-5)35-18-32)40-26(36-37)23-16-22(30)12-13-24(23)31/h6-8,10-13,16,19-20,25H,9,14-15,17H2,1-5H3,(H2,33,34,35)/t25-,29?/m0/s1 |
| InChIKey | QVMOZJPFYGXGIX-GMMLNUAGSA-N |
| XLogP | 5.18 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|