C25H28F2N6O2S — CID 87492836
1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-hydroxy-3-methylbutanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine (PubChem CID 87492836) has the molecular formula C25H28F2N6O2S and a molecular weight of 514.60 g/mol. Its IUPAC name is 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-hydroxy-3-methylbutanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-hydroxy-3-methylbutanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 87492836 |
| Molecular Formula | C25H28F2N6O2S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-hydroxy-3-methylbutanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)C(O)C(C)C |
| InChI | InChI=1S/C25H28F2N6O2S/c1-16(2)21(34)23(35)33-25(17-8-5-4-6-9-17,12-7-13-30-24(29-3)31-15-28)36-22(32-33)19-14-18(26)10-11-20(19)27/h4-6,8-11,14,16,21,34H,7,12-13H2,1-3H3,(H2,29,30,31) |
| InChIKey | BQRFBCZHAZEULB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|