C23H23F2N7O2S — CID 90812777
1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-nitrosopropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine (PubChem CID 90812777) has the molecular formula C23H23F2N7O2S and a molecular weight of 499.55 g/mol. Its IUPAC name is 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-nitrosopropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-nitrosopropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 90812777 |
| Molecular Formula | C23H23F2N7O2S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-nitrosopropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)C(C)N=O |
| InChI | InChI=1S/C23H23F2N7O2S/c1-15(31-34)21(33)32-23(16-7-4-3-5-8-16,11-6-12-28-22(27-2)29-14-26)35-20(30-32)18-13-17(24)9-10-19(18)25/h3-5,7-10,13,15H,6,11-12H2,1-2H3,(H2,27,28,29) |
| InChIKey | AGCDHEUWJHZWIT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|