C24H26F2N6OS — CID 24888217
1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine (PubChem CID 24888217) has the molecular formula C24H26F2N6OS and a molecular weight of 484.58 g/mol. Its IUPAC name is 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 24888217 |
| Molecular Formula | C24H26F2N6OS |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)C(C)C |
| InChI | InChI=1S/C24H26F2N6OS/c1-16(2)22(33)32-24(17-8-5-4-6-9-17,12-7-13-29-23(28-3)30-15-27)34-21(31-32)19-14-18(25)10-11-20(19)26/h4-6,8-11,14,16H,7,12-13H2,1-3H3,(H2,28,29,30) |
| InChIKey | KQGFESSBZYPXMF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|