C25H27F2N6O5PS — CID 87493561
[(1S)-2-[2-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-1-cyclopropyl-2-oxoethyl] dihydrogen phosphate (PubChem CID 87493561) has the molecular formula C25H27F2N6O5PS and a molecular weight of 592.57 g/mol. Its IUPAC name is [(1S)-2-[2-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-1-cyclopropyl-2-oxoethyl] dihydrogen phosphate.
| Compound Name | [(1S)-2-[2-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-1-cyclopropyl-2-oxoethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87493561 |
| Molecular Formula | C25H27F2N6O5PS |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | [(1S)-2-[2-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-1-cyclopropyl-2-oxoethyl] dihydrogen phosphate |
| SMILES | C/N=C(\NC#N)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@@H](OP(=O)(O)O)C1CC1 |
| InChI | InChI=1S/C25H27F2N6O5PS/c1-29-24(31-15-28)30-13-5-12-25(17-6-3-2-4-7-17)33(23(34)21(16-8-9-16)38-39(35,36)37)32-22(40-25)19-14-18(26)10-11-20(19)27/h2-4,6-7,10-11,14,16,21H,5,8-9,12-13H2,1H3,(H2,29,30,31)(H2,35,36,37)/t21-,25?/m0/s1 |
| InChIKey | FFSCBCGPYUYOOR-BWDMCYIDSA-N |
| XLogP | 3.37 |
| TPSA | 159.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|