C23H25F2N7S2 — CID 68785456
1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2,3-dimethylguanidine (PubChem CID 68785456) has the molecular formula C23H25F2N7S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2,3-dimethylguanidine.
| Compound Name | 1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 68785456 |
| Molecular Formula | C23H25F2N7S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 1-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1c1nnc(C)s1 |
| InChI | InChI=1S/C23H25F2N7S2/c1-15-29-30-22(33-15)32-23(16-8-5-4-6-9-16,12-7-13-28-21(26-2)27-3)34-20(31-32)18-14-17(24)10-11-19(18)25/h4-6,8-11,14H,7,12-13H2,1-3H3,(H2,26,27,28) |
| InChIKey | CBGAZXHZINWGAG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|