C27H32F2N6O2S — CID 87493921
1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxy-3,3-dimethylbutanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine (PubChem CID 87493921) has the molecular formula C27H32F2N6O2S and a molecular weight of 542.66 g/mol. Its IUPAC name is 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxy-3,3-dimethylbutanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxy-3,3-dimethylbutanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 87493921 |
| Molecular Formula | C27H32F2N6O2S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 1-cyano-3-[3-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxy-3,3-dimethylbutanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@@H](OC)C(C)(C)C |
| InChI | InChI=1S/C27H32F2N6O2S/c1-26(2,3)22(37-5)24(36)35-27(18-10-7-6-8-11-18,14-9-15-32-25(31-4)33-17-30)38-23(34-35)20-16-19(28)12-13-21(20)29/h6-8,10-13,16,22H,9,14-15H2,1-5H3,(H2,31,32,33)/t22-,27?/m1/s1 |
| InChIKey | RMOBKKJKEUKCAN-XVPAFAEQSA-N |
| XLogP | 4.54 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|