C22H23F2N7S2 — CID 68503309
N'-[2-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl-methylamino]ethanimidamide (PubChem CID 68503309) has the molecular formula C22H23F2N7S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is N'-[2-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl-methylamino]ethanimidamide.
| Compound Name | N'-[2-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl-methylamino]ethanimidamide |
|---|---|
| PubChem CID | 68503309 |
| Molecular Formula | C22H23F2N7S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N'-[2-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl-methylamino]ethanimidamide |
| SMILES | CC(N)=NN(C)CCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1c1nnc(C)s1 |
| InChI | InChI=1S/C22H23F2N7S2/c1-14(25)28-30(3)12-11-22(16-7-5-4-6-8-16)31(21-27-26-15(2)32-21)29-20(33-22)18-13-17(23)9-10-19(18)24/h4-10,13H,11-12H2,1-3H3,(H2,25,28) |
| InChIKey | UFKBOVPRXKUSOX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|