C25H28F2N6OS2 — CID 68505728
N-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-3-(dimethylamino)propanamide (PubChem CID 68505728) has the molecular formula C25H28F2N6OS2 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-3-(dimethylamino)propanamide.
| Compound Name | N-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-3-(dimethylamino)propanamide |
|---|---|
| PubChem CID | 68505728 |
| Molecular Formula | C25H28F2N6OS2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | N-[3-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-3-(dimethylamino)propanamide |
| SMILES | Cc1nnc(N2N=C(c3cc(F)ccc3F)SC2(CCCNC(=O)CCN(C)C)c2ccccc2)s1 |
| InChI | InChI=1S/C25H28F2N6OS2/c1-17-29-30-24(35-17)33-25(18-8-5-4-6-9-18,13-7-14-28-22(34)12-15-32(2)3)36-23(31-33)20-16-19(26)10-11-21(20)27/h4-6,8-11,16H,7,12-15H2,1-3H3,(H,28,34) |
| InChIKey | QMRPJIFVEWERCK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|