C26H31F2N5O4S — CID 160693156
(2S)-2-[3-[(6-amino-3-oxohexanoyl)amino]propyl]-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide (PubChem CID 160693156) has the molecular formula C26H31F2N5O4S and a molecular weight of 547.63 g/mol. Its IUPAC name is (2S)-2-[3-[(6-amino-3-oxohexanoyl)amino]propyl]-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide.
| Compound Name | (2S)-2-[3-[(6-amino-3-oxohexanoyl)amino]propyl]-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 160693156 |
| Molecular Formula | C26H31F2N5O4S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | (2S)-2-[3-[(6-amino-3-oxohexanoyl)amino]propyl]-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
| SMILES | CON(C)C(=O)N1N=C(c2cc(F)ccc2F)S[C@@]1(CCCNC(=O)CC(=O)CCCN)c1ccccc1 |
| InChI | InChI=1S/C26H31F2N5O4S/c1-32(37-2)25(36)33-26(18-8-4-3-5-9-18,13-7-15-30-23(35)17-20(34)10-6-14-29)38-24(31-33)21-16-19(27)11-12-22(21)28/h3-5,8-9,11-12,16H,6-7,10,13-15,17,29H2,1-2H3,(H,30,35)/t26-/m0/s1 |
| InChIKey | RPQYAHSOGURWFB-SANMLTNESA-N |
| XLogP | 3.74 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|