C19H19F2N3O3S — CID 87391567
5-(2,5-difluorophenyl)-2-(2-hydroxyethyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide (PubChem CID 87391567) has the molecular formula C19H19F2N3O3S and a molecular weight of 407.44 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-2-(2-hydroxyethyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide.
| Compound Name | 5-(2,5-difluorophenyl)-2-(2-hydroxyethyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 87391567 |
| Molecular Formula | C19H19F2N3O3S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 5-(2,5-difluorophenyl)-2-(2-hydroxyethyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
| SMILES | CON(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCO)c1ccccc1 |
| InChI | InChI=1S/C19H19F2N3O3S/c1-23(27-2)18(26)24-19(10-11-25,13-6-4-3-5-7-13)28-17(22-24)15-12-14(20)8-9-16(15)21/h3-9,12,25H,10-11H2,1-2H3 |
| InChIKey | ZCYFPDOGOIUYLT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|